C19H22CrO5 — CID 11773467
carbon monoxide;chromium;(1S,4E)-4-ethylidene-7,8-dimethoxy-1,6-dimethyl-2,3-dihydro-1H-naphthalene (PubChem CID 11773467) has the molecular formula C19H22CrO5 and a molecular weight of 382.38 g/mol. Its IUPAC name is carbon monoxide;chromium;(1S,4E)-4-ethylidene-7,8-dimethoxy-1,6-dimethyl-2,3-dihydro-1H-naphthalene.
| Compound Name | carbon monoxide;chromium;(1S,4E)-4-ethylidene-7,8-dimethoxy-1,6-dimethyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 11773467 |
| Molecular Formula | C19H22CrO5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | carbon monoxide;chromium;(1S,4E)-4-ethylidene-7,8-dimethoxy-1,6-dimethyl-2,3-dihydro-1H-naphthalene |
| SMILES | C/C=C1\CC[C@H](C)c2c1cc(C)c(OC)c2OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C16H22O2.3CO.Cr/c1-6-12-8-7-10(2)14-13(12)9-11(3)15(17-4)16(14)18-5;3*1-2;/h6,9-10H,7-8H2,1-5H3;;;;/b12-6+;;;;/t10-;;;;/m0..../s1 |
| InChIKey | WJBJXLWAGBPSGR-SPJPFMQESA-N |
| XLogP | 4.20 |
| TPSA | 78.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|