C12H23NO — CID 145358732
ethane;N-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethanamine (PubChem CID 145358732) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is ethane;N-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethanamine.
| Compound Name | ethane;N-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 145358732 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | ethane;N-ethyl-2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethanamine |
| SMILES | C=C/C=C(\C=C)OCCNCC.CC |
| InChI | InChI=1S/C10H17NO.C2H6/c1-4-7-10(5-2)12-9-8-11-6-3;1-2/h4-5,7,11H,1-2,6,8-9H2,3H3;1-2H3/b10-7+; |
| InChIKey | RSFGMNFXJGEBQD-HCUGZAAXSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|