About 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen
2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen (PubChem CID 145358889) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen.
Analyze 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen?
The IUPAC name of 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen (CID 145358889) is 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen.
What is the SMILES notation for 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen?
The canonical SMILES for 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen is CCc1c(C)ccc(C(C)C)c1NC.[H][H].
What is the InChIKey of 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen?
The InChIKey is YMWSWOUYQSGYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N.H2/c1-6-11-10(4)7-8-12(9(2)3)13(11)14-5;/h7-9,14H,6H2,1-5H3;1H.
What are the key properties of 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen?
2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen has a molecular weight of 193.33 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,3-dimethyl-6-propan-2-ylaniline;molecular hydrogen is sourced from PubChem (CID 145358889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).