C31H46BF3N4O4Si- — CID 145360227
CID 145360227 (PubChem CID 145360227) has the molecular formula C31H46BF3N4O4Si- and a molecular weight of 634.63 g/mol.
| Compound Name | CID 145360227 |
|---|---|
| PubChem CID | 145360227 |
| Molecular Formula | C31H46BF3N4O4Si- |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | — |
| SMILES | C[C@@H]1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2NC(=O)c2cnc(OCC[Si-](C)(C)C)cc2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C31H46BF3N4O4Si/c1-20-18-39(19-21(2)38(20)7)26-12-11-22(32-42-29(3,4)30(5,6)43-32)15-25(26)37-28(40)23-17-36-27(16-24(23)31(33,34)35)41-13-14-44(8,9)10/h11-12,15-17,20-21H,13-14,18-19H2,1-10H3,(H,37,40)/q-1/t20-,21+ |
| InChIKey | UAHWIWRGHAFGMC-OYRHEFFESA-N |
| XLogP | 5.90 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|