C13H16F3N5OS — CID 145363305
N-[(E)-C-aminocarbonohydrazonoyl]-1-[3-(trifluoromethyl)phenyl]sulfanylpyrrolidine-3-carboxamide (PubChem CID 145363305) has the molecular formula C13H16F3N5OS and a molecular weight of 347.37 g/mol. Its IUPAC name is N-[(E)-C-aminocarbonohydrazonoyl]-1-[3-(trifluoromethyl)phenyl]sulfanylpyrrolidine-3-carboxamide.
| Compound Name | N-[(E)-C-aminocarbonohydrazonoyl]-1-[3-(trifluoromethyl)phenyl]sulfanylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 145363305 |
| Molecular Formula | C13H16F3N5OS |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[(E)-C-aminocarbonohydrazonoyl]-1-[3-(trifluoromethyl)phenyl]sulfanylpyrrolidine-3-carboxamide |
| SMILES | N/N=C(\N)NC(=O)C1CCN(Sc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H16F3N5OS/c14-13(15,16)9-2-1-3-10(6-9)23-21-5-4-8(7-21)11(22)19-12(17)20-18/h1-3,6,8H,4-5,7,18H2,(H3,17,19,20,22) |
| InChIKey | DMELHQRJTXZWHG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|