C23H25F3N6O — CID 145364918
N-(5-tert-butyl-1H-pyrazol-3-yl)formamide;N-methyl-4-[5-(trifluoromethyl)benzimidazol-1-yl]aniline (PubChem CID 145364918) has the molecular formula C23H25F3N6O and a molecular weight of 458.49 g/mol. Its IUPAC name is N-(5-tert-butyl-1H-pyrazol-3-yl)formamide;N-methyl-4-[5-(trifluoromethyl)benzimidazol-1-yl]aniline.
| Compound Name | N-(5-tert-butyl-1H-pyrazol-3-yl)formamide;N-methyl-4-[5-(trifluoromethyl)benzimidazol-1-yl]aniline |
|---|---|
| PubChem CID | 145364918 |
| Molecular Formula | C23H25F3N6O |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-(5-tert-butyl-1H-pyrazol-3-yl)formamide;N-methyl-4-[5-(trifluoromethyl)benzimidazol-1-yl]aniline |
| SMILES | CC(C)(C)c1cc(NC=O)n[nH]1.CNc1ccc(-n2cnc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C15H12F3N3.C8H13N3O/c1-19-11-3-5-12(6-4-11)21-9-20-13-8-10(15(16,17)18)2-7-14(13)21;1-8(2,3)6-4-7(9-5-12)11-10-6/h2-9,19H,1H3;4-5H,1-3H3,(H2,9,10,11,12) |
| InChIKey | ALKYVRSPGRZPPP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|