C26H28N6O3 — CID 175590345
1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-hydroxypent-4-ynoxy)benzimidazol-1-yl]phenyl]urea (PubChem CID 175590345) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-hydroxypent-4-ynoxy)benzimidazol-1-yl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-hydroxypent-4-ynoxy)benzimidazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 175590345 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-hydroxypent-4-ynoxy)benzimidazol-1-yl]phenyl]urea |
| SMILES | C#CCC(O)COc1ccc2c(c1)ncn2-c1ccc(NC(=O)Nc2cc(C(C)(C)C)[nH]n2)cc1 |
| InChI | InChI=1S/C26H28N6O3/c1-5-6-19(33)15-35-20-11-12-22-21(13-20)27-16-32(22)18-9-7-17(8-10-18)28-25(34)29-24-14-23(30-31-24)26(2,3)4/h1,7-14,16,19,33H,6,15H2,2-4H3,(H3,28,29,30,31,34) |
| InChIKey | RQFNOHBVCVPVNQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|