C41H46N8O5 — CID 162680618
1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptoxy]benzimidazol-1-yl]phenyl]urea (PubChem CID 162680618) has the molecular formula C41H46N8O5 and a molecular weight of 730.87 g/mol. Its IUPAC name is 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptoxy]benzimidazol-1-yl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptoxy]benzimidazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 162680618 |
| Molecular Formula | C41H46N8O5 |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.36 |
| IUPAC Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-[7-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]heptoxy]benzimidazol-1-yl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-n3cnc4cc(OCCCCCCCc5cccc6c5CN(C5CCC(=O)NC5=O)C6=O)ccc43)cc2)n[nH]1 |
| InChI | InChI=1S/C41H46N8O5/c1-41(2,3)35-23-36(47-46-35)44-40(53)43-27-13-15-28(16-14-27)49-25-42-32-22-29(17-18-33(32)49)54-21-8-6-4-5-7-10-26-11-9-12-30-31(26)24-48(39(30)52)34-19-20-37(50)45-38(34)51/h9,11-18,22-23,25,34H,4-8,10,19-21,24H2,1-3H3,(H,45,50,51)(H3,43,44,46,47,53) |
| InChIKey | BGBNFPNLSMWTJV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|