C25H30N6O3 — CID 130424450
1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-ethoxyethoxy)benzimidazol-1-yl]phenyl]urea (PubChem CID 130424450) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-ethoxyethoxy)benzimidazol-1-yl]phenyl]urea.
| Compound Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-ethoxyethoxy)benzimidazol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 130424450 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 1-(5-tert-butyl-1H-pyrazol-3-yl)-3-[4-[5-(2-ethoxyethoxy)benzimidazol-1-yl]phenyl]urea |
| SMILES | CCOCCOc1ccc2c(c1)ncn2-c1ccc(NC(=O)Nc2cc(C(C)(C)C)[nH]n2)cc1 |
| InChI | InChI=1S/C25H30N6O3/c1-5-33-12-13-34-19-10-11-21-20(14-19)26-16-31(21)18-8-6-17(7-9-18)27-24(32)28-23-15-22(29-30-23)25(2,3)4/h6-11,14-16H,5,12-13H2,1-4H3,(H3,27,28,29,30,32) |
| InChIKey | HUMATPOBPPUPDE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|