C22H19N3O3 — CID 174930301
phenyl N-[4-(5-ethoxybenzimidazol-1-yl)phenyl]carbamate (PubChem CID 174930301) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is phenyl N-[4-(5-ethoxybenzimidazol-1-yl)phenyl]carbamate.
| Compound Name | phenyl N-[4-(5-ethoxybenzimidazol-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 174930301 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | phenyl N-[4-(5-ethoxybenzimidazol-1-yl)phenyl]carbamate |
| SMILES | CCOc1ccc2c(c1)ncn2-c1ccc(NC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-2-27-19-12-13-21-20(14-19)23-15-25(21)17-10-8-16(9-11-17)24-22(26)28-18-6-4-3-5-7-18/h3-15H,2H2,1H3,(H,24,26) |
| InChIKey | AMOQYGFWQKCNHD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |