C27H23N5O4 — CID 137487951
4-[1-[4-[[hydroxy(phenoxy)methyl]amino]phenyl]benzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide (PubChem CID 137487951) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is 4-[1-[4-[[hydroxy(phenoxy)methyl]amino]phenyl]benzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[1-[4-[[hydroxy(phenoxy)methyl]amino]phenyl]benzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 137487951 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 4-[1-[4-[[hydroxy(phenoxy)methyl]amino]phenyl]benzimidazol-5-yl]oxy-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc3c(c2)ncn3-c2ccc(NC(O)Oc3ccccc3)cc2)ccn1 |
| InChI | InChI=1S/C27H23N5O4/c1-28-26(33)24-16-22(13-14-29-24)35-21-11-12-25-23(15-21)30-17-32(25)19-9-7-18(8-10-19)31-27(34)36-20-5-3-2-4-6-20/h2-17,27,31,34H,1H3,(H,28,33) |
| InChIKey | HMIPLXJFIXDTJL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|