C17H29NS — CID 145365228
2,4-dimethyl-1-phenylpent-4-en-2-amine;2-methylpropane-2-thiol (PubChem CID 145365228) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is 2,4-dimethyl-1-phenylpent-4-en-2-amine;2-methylpropane-2-thiol.
| Compound Name | 2,4-dimethyl-1-phenylpent-4-en-2-amine;2-methylpropane-2-thiol |
|---|---|
| PubChem CID | 145365228 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2,4-dimethyl-1-phenylpent-4-en-2-amine;2-methylpropane-2-thiol |
| SMILES | C=C(C)CC(C)(N)Cc1ccccc1.CC(C)(C)S |
| InChI | InChI=1S/C13H19N.C4H10S/c1-11(2)9-13(3,14)10-12-7-5-4-6-8-12;1-4(2,3)5/h4-8H,1,9-10,14H2,2-3H3;5H,1-3H3 |
| InChIKey | XGMXMWWYNIUZQL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|