C23H21N3OS — CID 145365389
2-[4-(methylamino)phenyl]-N-[4-[(E)-prop-1-enoxy]phenyl]thieno[2,3-b]pyridin-6-amine (PubChem CID 145365389) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[4-(methylamino)phenyl]-N-[4-[(E)-prop-1-enoxy]phenyl]thieno[2,3-b]pyridin-6-amine.
| Compound Name | 2-[4-(methylamino)phenyl]-N-[4-[(E)-prop-1-enoxy]phenyl]thieno[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 145365389 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[4-(methylamino)phenyl]-N-[4-[(E)-prop-1-enoxy]phenyl]thieno[2,3-b]pyridin-6-amine |
| SMILES | C/C=C/Oc1ccc(Nc2ccc3cc(-c4ccc(NC)cc4)sc3n2)cc1 |
| InChI | InChI=1S/C23H21N3OS/c1-3-14-27-20-11-9-19(10-12-20)25-22-13-6-17-15-21(28-23(17)26-22)16-4-7-18(24-2)8-5-16/h3-15,24H,1-2H3,(H,25,26)/b14-3+ |
| InChIKey | MALFTYXKVMZGMF-LZWSPWQCSA-N |
| XLogP | 6.66 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|