C10H17N — CID 145365403
(Z)-N-ethenyl-2-methylhept-2-en-1-imine (PubChem CID 145365403) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (Z)-N-ethenyl-2-methylhept-2-en-1-imine.
| Compound Name | (Z)-N-ethenyl-2-methylhept-2-en-1-imine |
|---|---|
| PubChem CID | 145365403 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (Z)-N-ethenyl-2-methylhept-2-en-1-imine |
| SMILES | C=C/N=C/C(C)=C\CCCC |
| InChI | InChI=1S/C10H17N/c1-4-6-7-8-10(3)9-11-5-2/h5,8-9H,2,4,6-7H2,1,3H3/b10-8-,11-9+ |
| InChIKey | BBHNTNNTIDASCJ-PNQPDEHRSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|