C17H22F3N3O3 — CID 145365663
1-(2-methylpentan-2-yl)-4-(trifluoromethoxy)benzene;1-methyltriazole-4-carboxylic acid (PubChem CID 145365663) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-(2-methylpentan-2-yl)-4-(trifluoromethoxy)benzene;1-methyltriazole-4-carboxylic acid.
| Compound Name | 1-(2-methylpentan-2-yl)-4-(trifluoromethoxy)benzene;1-methyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 145365663 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-(2-methylpentan-2-yl)-4-(trifluoromethoxy)benzene;1-methyltriazole-4-carboxylic acid |
| SMILES | CCCC(C)(C)c1ccc(OC(F)(F)F)cc1.Cn1cc(C(=O)O)nn1 |
| InChI | InChI=1S/C13H17F3O.C4H5N3O2/c1-4-9-12(2,3)10-5-7-11(8-6-10)17-13(14,15)16;1-7-2-3(4(8)9)5-6-7/h5-8H,4,9H2,1-3H3;2H,1H3,(H,8,9) |
| InChIKey | VFSGAGZUZQFFPK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |