C22H20FN6P — CID 145366255
4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane (PubChem CID 145366255) has the molecular formula C22H20FN6P and a molecular weight of 418.42 g/mol. Its IUPAC name is 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane.
| Compound Name | 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane |
|---|---|
| PubChem CID | 145366255 |
| Molecular Formula | C22H20FN6P |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane |
| SMILES | CCc1cc2ccc(P)cc2nc1-c1cccc(F)c1.N#Cc1c(N)ncnc1N |
| InChI | InChI=1S/C17H15FNP.C5H5N5/c1-2-11-8-12-6-7-15(20)10-16(12)19-17(11)13-4-3-5-14(18)9-13;6-1-3-4(7)9-2-10-5(3)8/h3-10H,2,20H2,1H3;2H,(H4,7,8,9,10) |
| InChIKey | GPHOKFVWKNHUHJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|