About 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane
4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane (PubChem CID 145366255) has the molecular formula C22H20FN6P
and a molecular weight of 418.42 g/mol. Its IUPAC name is 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane.
Molecular Properties
| Compound Name | 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane |
| PubChem CID | 145366255 |
| Molecular Formula | C22H20FN6P |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane |
| SMILES | CCc1cc2ccc(P)cc2nc1-c1cccc(F)c1.N#Cc1c(N)ncnc1N |
| InChI | InChI=1S/C17H15FNP.C5H5N5/c1-2-11-8-12-6-7-15(20)10-16(12)19-17(11)13-4-3-5-14(18)9-13;6-1-3-4(7)9-2-10-5(3)8/h3-10H,2,20H2,1H3;2H,(H4,7,8,9,10) |
| InChIKey | GPHOKFVWKNHUHJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane?
The IUPAC name of 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane (CID 145366255) is 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane.
What is the SMILES notation for 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane?
The canonical SMILES for 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane is CCc1cc2ccc(P)cc2nc1-c1cccc(F)c1.N#Cc1c(N)ncnc1N.
What is the InChIKey of 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane?
The InChIKey is GPHOKFVWKNHUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FNP.C5H5N5/c1-2-11-8-12-6-7-15(20)10-16(12)19-17(11)13-4-3-5-14(18)9-13;6-1-3-4(7)9-2-10-5(3)8/h3-10H,2,20H2,1H3;2H,(H4,7,8,9,10).
What are the key properties of 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane?
4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane has a molecular weight of 418.42 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diaminopyrimidine-5-carbonitrile;[3-ethyl-2-(3-fluorophenyl)quinolin-7-yl]phosphane is sourced from PubChem (CID 145366255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).