C14H10ClF2NO2S — CID 145366859
4-chloro-N-(3,4-difluoro-2-methylphenyl)-3-hydroxysulfanylbenzamide (PubChem CID 145366859) has the molecular formula C14H10ClF2NO2S and a molecular weight of 329.76 g/mol. Its IUPAC name is 4-chloro-N-(3,4-difluoro-2-methylphenyl)-3-hydroxysulfanylbenzamide.
| Compound Name | 4-chloro-N-(3,4-difluoro-2-methylphenyl)-3-hydroxysulfanylbenzamide |
|---|---|
| PubChem CID | 145366859 |
| Molecular Formula | C14H10ClF2NO2S |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4-chloro-N-(3,4-difluoro-2-methylphenyl)-3-hydroxysulfanylbenzamide |
| SMILES | Cc1c(NC(=O)c2ccc(Cl)c(SO)c2)ccc(F)c1F |
| InChI | InChI=1S/C14H10ClF2NO2S/c1-7-11(5-4-10(16)13(7)17)18-14(19)8-2-3-9(15)12(6-8)21-20/h2-6,20H,1H3,(H,18,19) |
| InChIKey | XVDYVIBRPCIROY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|