C27H25FN2O3S — CID 145367077
5-pyridin-4-ylpent-4-enyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate (PubChem CID 145367077) has the molecular formula C27H25FN2O3S and a molecular weight of 476.57 g/mol. Its IUPAC name is 5-pyridin-4-ylpent-4-enyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate.
| Compound Name | 5-pyridin-4-ylpent-4-enyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 145367077 |
| Molecular Formula | C27H25FN2O3S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 5-pyridin-4-ylpent-4-enyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OCCCC=Cc2ccncc2)ccc1N1C(=O)CSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H25FN2O3S/c1-19-17-22(27(32)33-16-4-2-3-5-20-12-14-29-15-13-20)8-11-24(19)30-25(31)18-34-26(30)21-6-9-23(28)10-7-21/h3,5-15,17,26H,2,4,16,18H2,1H3 |
| InChIKey | DSMGPNNSMYJPSV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|