C26H31FN2O4S — CID 175173216
5-morpholin-2-ylpentyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate (PubChem CID 175173216) has the molecular formula C26H31FN2O4S and a molecular weight of 486.61 g/mol. Its IUPAC name is 5-morpholin-2-ylpentyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate.
| Compound Name | 5-morpholin-2-ylpentyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 175173216 |
| Molecular Formula | C26H31FN2O4S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 5-morpholin-2-ylpentyl 4-[2-(4-fluorophenyl)-4-oxo-1,3-thiazolidin-3-yl]-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)OCCCCCC2CNCCO2)ccc1N1C(=O)CSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H31FN2O4S/c1-18-15-20(26(31)33-13-4-2-3-5-22-16-28-12-14-32-22)8-11-23(18)29-24(30)17-34-25(29)19-6-9-21(27)10-7-19/h6-11,15,22,25,28H,2-5,12-14,16-17H2,1H3 |
| InChIKey | DWNHATBXQJFBSR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|