C24H37F2N4O7P — CID 145367225
ethane;phenol;propan-2-yl 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxyphosphanylamino]propanoate (PubChem CID 145367225) has the molecular formula C24H37F2N4O7P and a molecular weight of 562.55 g/mol. Its IUPAC name is ethane;phenol;propan-2-yl 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxyphosphanylamino]propanoate.
| Compound Name | ethane;phenol;propan-2-yl 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxyphosphanylamino]propanoate |
|---|---|
| PubChem CID | 145367225 |
| Molecular Formula | C24H37F2N4O7P |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | ethane;phenol;propan-2-yl 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]methoxyphosphanylamino]propanoate |
| SMILES | CC.CC(C)OC(=O)C(C)NPOCC1OC(n2ccc(N)nc2=O)C(F)(CF)C1O.Oc1ccccc1 |
| InChI | InChI=1S/C16H25F2N4O6P.C6H6O.C2H6/c1-8(2)27-13(24)9(3)21-29-26-6-10-12(23)16(18,7-17)14(28-10)22-5-4-11(19)20-15(22)25;7-6-4-2-1-3-5-6;1-2/h4-5,8-10,12,14,21,23,29H,6-7H2,1-3H3,(H2,19,20,25);1-5,7H;1-2H3 |
| InChIKey | FDRIIFKMFMLXRR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|