C14H17ClN2O — CID 145367439
4-chloro-1,5-dimethylindole-2-carboxamide;prop-1-ene (PubChem CID 145367439) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 4-chloro-1,5-dimethylindole-2-carboxamide;prop-1-ene.
| Compound Name | 4-chloro-1,5-dimethylindole-2-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 145367439 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-chloro-1,5-dimethylindole-2-carboxamide;prop-1-ene |
| SMILES | C=CC.Cc1ccc2c(cc(C(N)=O)n2C)c1Cl |
| InChI | InChI=1S/C11H11ClN2O.C3H6/c1-6-3-4-8-7(10(6)12)5-9(11(13)15)14(8)2;1-3-2/h3-5H,1-2H3,(H2,13,15);3H,1H2,2H3 |
| InChIKey | MDRSDSKAKLOEBZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|