C20H18ClN5OS — CID 145367749
4-chloro-1,5-dimethyl-N-[4-(1H-pyrazol-5-ylamino)sulfanylphenyl]indole-2-carboxamide (PubChem CID 145367749) has the molecular formula C20H18ClN5OS and a molecular weight of 411.92 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyl-N-[4-(1H-pyrazol-5-ylamino)sulfanylphenyl]indole-2-carboxamide.
| Compound Name | 4-chloro-1,5-dimethyl-N-[4-(1H-pyrazol-5-ylamino)sulfanylphenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 145367749 |
| Molecular Formula | C20H18ClN5OS |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-chloro-1,5-dimethyl-N-[4-(1H-pyrazol-5-ylamino)sulfanylphenyl]indole-2-carboxamide |
| SMILES | Cc1ccc2c(cc(C(=O)Nc3ccc(SNc4ccn[nH]4)cc3)n2C)c1Cl |
| InChI | InChI=1S/C20H18ClN5OS/c1-12-3-8-16-15(19(12)21)11-17(26(16)2)20(27)23-13-4-6-14(7-5-13)28-25-18-9-10-22-24-18/h3-11H,1-2H3,(H,23,27)(H2,22,24,25) |
| InChIKey | JCWLSNRNKDPHMX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|