C18H18Cl2N4O2 — CID 145367596
4,5-dichloro-N-[3-(2-diazoacetyl)cyclohexyl]-1-methylindole-2-carboxamide (PubChem CID 145367596) has the molecular formula C18H18Cl2N4O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 4,5-dichloro-N-[3-(2-diazoacetyl)cyclohexyl]-1-methylindole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-[3-(2-diazoacetyl)cyclohexyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 145367596 |
| Molecular Formula | C18H18Cl2N4O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4,5-dichloro-N-[3-(2-diazoacetyl)cyclohexyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2CCCC(C(=O)C=[N+]=[N-])C2)cc2c(Cl)c(Cl)ccc21 |
| InChI | InChI=1S/C18H18Cl2N4O2/c1-24-14-6-5-13(19)17(20)12(14)8-15(24)18(26)23-11-4-2-3-10(7-11)16(25)9-22-21/h5-6,8-11H,2-4,7H2,1H3,(H,23,26) |
| InChIKey | AEOIYOLCWDWKFV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|