C18H23Cl2N5O2S — CID 145367541
N-[1-acetamidosulfanyl-3-(aminomethyl)piperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide (PubChem CID 145367541) has the molecular formula C18H23Cl2N5O2S and a molecular weight of 444.39 g/mol. Its IUPAC name is N-[1-acetamidosulfanyl-3-(aminomethyl)piperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide.
| Compound Name | N-[1-acetamidosulfanyl-3-(aminomethyl)piperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 145367541 |
| Molecular Formula | C18H23Cl2N5O2S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-[1-acetamidosulfanyl-3-(aminomethyl)piperidin-4-yl]-4,5-dichloro-1-methylindole-2-carboxamide |
| SMILES | CC(=O)NSN1CCC(NC(=O)c2cc3c(Cl)c(Cl)ccc3n2C)C(CN)C1 |
| InChI | InChI=1S/C18H23Cl2N5O2S/c1-10(26)23-28-25-6-5-14(11(8-21)9-25)22-18(27)16-7-12-15(24(16)2)4-3-13(19)17(12)20/h3-4,7,11,14H,5-6,8-9,21H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | KBKMEVWTABOVAC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|