C28H33Cl2N5O4S — CID 145367385
tert-butyl N-[3-[1-acetamidosulfanyl-4-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]piperidin-4-yl]phenyl]carbamate (PubChem CID 145367385) has the molecular formula C28H33Cl2N5O4S and a molecular weight of 606.58 g/mol. Its IUPAC name is tert-butyl N-[3-[1-acetamidosulfanyl-4-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]piperidin-4-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-acetamidosulfanyl-4-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]piperidin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 145367385 |
| Molecular Formula | C28H33Cl2N5O4S |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | tert-butyl N-[3-[1-acetamidosulfanyl-4-[(4,5-dichloro-1-methylindole-2-carbonyl)amino]piperidin-4-yl]phenyl]carbamate |
| SMILES | CC(=O)NSN1CCC(NC(=O)c2cc3c(Cl)c(Cl)ccc3n2C)(c2cccc(NC(=O)OC(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C28H33Cl2N5O4S/c1-17(36)33-40-35-13-11-28(12-14-35,18-7-6-8-19(15-18)31-26(38)39-27(2,3)4)32-25(37)23-16-20-22(34(23)5)10-9-21(29)24(20)30/h6-10,15-16H,11-14H2,1-5H3,(H,31,38)(H,32,37)(H,33,36) |
| InChIKey | LMAXMGOKHGMLDO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|