C15H16Cl2N4O4S — CID 130408286
N-[1-(acetylsulfamoyl)azetidin-3-yl]-4,5-dichloro-1-methylindole-2-carboxamide (PubChem CID 130408286) has the molecular formula C15H16Cl2N4O4S and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[1-(acetylsulfamoyl)azetidin-3-yl]-4,5-dichloro-1-methylindole-2-carboxamide.
| Compound Name | N-[1-(acetylsulfamoyl)azetidin-3-yl]-4,5-dichloro-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 130408286 |
| Molecular Formula | C15H16Cl2N4O4S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-[1-(acetylsulfamoyl)azetidin-3-yl]-4,5-dichloro-1-methylindole-2-carboxamide |
| SMILES | CC(=O)NS(=O)(=O)N1CC(NC(=O)c2cc3c(Cl)c(Cl)ccc3n2C)C1 |
| InChI | InChI=1S/C15H16Cl2N4O4S/c1-8(22)19-26(24,25)21-6-9(7-21)18-15(23)13-5-10-12(20(13)2)4-3-11(16)14(10)17/h3-5,9H,6-7H2,1-2H3,(H,18,23)(H,19,22) |
| InChIKey | ZGPMUQNUHMAHKN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |