C14H25NO — CID 145368660
but-2-ynal;3-(2,2-dimethylpropyl)-1-methylpyrrolidine (PubChem CID 145368660) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is but-2-ynal;3-(2,2-dimethylpropyl)-1-methylpyrrolidine.
| Compound Name | but-2-ynal;3-(2,2-dimethylpropyl)-1-methylpyrrolidine |
|---|---|
| PubChem CID | 145368660 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | but-2-ynal;3-(2,2-dimethylpropyl)-1-methylpyrrolidine |
| SMILES | CC#CC=O.CN1CCC(CC(C)(C)C)C1 |
| InChI | InChI=1S/C10H21N.C4H4O/c1-10(2,3)7-9-5-6-11(4)8-9;1-2-3-4-5/h9H,5-8H2,1-4H3;4H,1H3 |
| InChIKey | YFPIQFMUQNGRKU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|