C14H14F3N5O — CID 145369579
5-methoxy-2-[2-(2,2,2-trifluoroethylamino)benzenecarboximidoyl]pyrimidin-4-amine (PubChem CID 145369579) has the molecular formula C14H14F3N5O and a molecular weight of 325.29 g/mol. Its IUPAC name is 5-methoxy-2-[2-(2,2,2-trifluoroethylamino)benzenecarboximidoyl]pyrimidin-4-amine.
| Compound Name | 5-methoxy-2-[2-(2,2,2-trifluoroethylamino)benzenecarboximidoyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145369579 |
| Molecular Formula | C14H14F3N5O |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-methoxy-2-[2-(2,2,2-trifluoroethylamino)benzenecarboximidoyl]pyrimidin-4-amine |
| SMILES | [H]/N=C(\c1ncc(OC)c(N)n1)c1ccccc1NCC(F)(F)F |
| InChI | InChI=1S/C14H14F3N5O/c1-23-10-6-20-13(22-12(10)19)11(18)8-4-2-3-5-9(8)21-7-14(15,16)17/h2-6,18,21H,7H2,1H3,(H2,19,20,22)/b18-11- |
| InChIKey | HXZKBLXZUQHQIQ-WQRHYEAKSA-N |
| XLogP | 2.46 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|