C18H28O6 — CID 145370263
2-[1-hydroxy-3-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]oxypropan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 145370263) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-[1-hydroxy-3-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]oxypropan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[1-hydroxy-3-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]oxypropan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 145370263 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-[1-hydroxy-3-[(2E,4Z)-3-methylhexa-2,4-dien-2-yl]oxypropan-2-yl]oxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | C/C=C\C(C)=C(/C)OCC(CO)OC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C18H28O6/c1-4-7-12(2)13(3)23-11-14(10-19)24-18(22)16-9-6-5-8-15(16)17(20)21/h4,7,14-16,19H,5-6,8-11H2,1-3H3,(H,20,21)/b7-4-,13-12+ |
| InChIKey | UURCDIKAMBARDX-ZQDYKODVSA-N |
| XLogP | 2.67 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|