C20H20BrN — CID 145370589
3-bromo-5-[3-methyl-4-(2-methylcyclohexa-2,4-dien-1-yl)phenyl]aniline (PubChem CID 145370589) has the molecular formula C20H20BrN and a molecular weight of 354.29 g/mol. Its IUPAC name is 3-bromo-5-[3-methyl-4-(2-methylcyclohexa-2,4-dien-1-yl)phenyl]aniline.
| Compound Name | 3-bromo-5-[3-methyl-4-(2-methylcyclohexa-2,4-dien-1-yl)phenyl]aniline |
|---|---|
| PubChem CID | 145370589 |
| Molecular Formula | C20H20BrN |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-bromo-5-[3-methyl-4-(2-methylcyclohexa-2,4-dien-1-yl)phenyl]aniline |
| SMILES | CC1=CC=CCC1c1ccc(-c2cc(N)cc(Br)c2)cc1C |
| InChI | InChI=1S/C20H20BrN/c1-13-5-3-4-6-19(13)20-8-7-15(9-14(20)2)16-10-17(21)12-18(22)11-16/h3-5,7-12,19H,6,22H2,1-2H3 |
| InChIKey | XDWGVJRFXZSICT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|