C9H17F2N — CID 145372081
2,3-difluoro-4-(2-methylpropyl)piperidine (PubChem CID 145372081) has the molecular formula C9H17F2N and a molecular weight of 177.24 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-methylpropyl)piperidine.
| Compound Name | 2,3-difluoro-4-(2-methylpropyl)piperidine |
|---|---|
| PubChem CID | 145372081 |
| Molecular Formula | C9H17F2N |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2,3-difluoro-4-(2-methylpropyl)piperidine |
| SMILES | CC(C)CC1CCNC(F)C1F |
| InChI | InChI=1S/C9H17F2N/c1-6(2)5-7-3-4-12-9(11)8(7)10/h6-9,12H,3-5H2,1-2H3 |
| InChIKey | SIGLTPIMMAICDW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|