C10H15F5 — CID 164775045
1,2,3,4,5-pentafluoro-6-(2-methylpropyl)cyclohexane (PubChem CID 164775045) has the molecular formula C10H15F5 and a molecular weight of 230.22 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2-methylpropyl)cyclohexane.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2-methylpropyl)cyclohexane |
|---|---|
| PubChem CID | 164775045 |
| Molecular Formula | C10H15F5 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2-methylpropyl)cyclohexane |
| SMILES | CC(C)CC1C(F)C(F)C(F)C(F)C1F |
| InChI | InChI=1S/C10H15F5/c1-4(2)3-5-6(11)8(13)10(15)9(14)7(5)12/h4-10H,3H2,1-2H3 |
| InChIKey | HIYKBQADIFTKCY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |