C14H19NOS — CID 145373436
(2E)-N-benzyl-5-methylhexa-2,4-diene-3-sulfinamide (PubChem CID 145373436) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is (2E)-N-benzyl-5-methylhexa-2,4-diene-3-sulfinamide.
| Compound Name | (2E)-N-benzyl-5-methylhexa-2,4-diene-3-sulfinamide |
|---|---|
| PubChem CID | 145373436 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (2E)-N-benzyl-5-methylhexa-2,4-diene-3-sulfinamide |
| SMILES | C/C=C(\C=C(C)C)S(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H19NOS/c1-4-14(10-12(2)3)17(16)15-11-13-8-6-5-7-9-13/h4-10,15H,11H2,1-3H3/b14-4+ |
| InChIKey | KCRMHFYHMSZUEW-LNKIKWGQSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|