C13H14BFN2O2 — CID 145374918
methyl 3-(4-cyano-1,4-azaborinan-1-yl)-5-fluorobenzoate (PubChem CID 145374918) has the molecular formula C13H14BFN2O2 and a molecular weight of 260.08 g/mol. Its IUPAC name is methyl 3-(4-cyano-1,4-azaborinan-1-yl)-5-fluorobenzoate.
| Compound Name | methyl 3-(4-cyano-1,4-azaborinan-1-yl)-5-fluorobenzoate |
|---|---|
| PubChem CID | 145374918 |
| Molecular Formula | C13H14BFN2O2 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | methyl 3-(4-cyano-1,4-azaborinan-1-yl)-5-fluorobenzoate |
| SMILES | COC(=O)c1cc(F)cc(N2CCB(C#N)CC2)c1 |
| InChI | InChI=1S/C13H14BFN2O2/c1-19-13(18)10-6-11(15)8-12(7-10)17-4-2-14(9-16)3-5-17/h6-8H,2-5H2,1H3 |
| InChIKey | AKOOBQNGFVBSPC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|