C14H14BN3O2 — CID 156711640
methyl 2-cyano-4-(4-cyano-1,4-azaborinan-1-yl)benzoate (PubChem CID 156711640) has the molecular formula C14H14BN3O2 and a molecular weight of 267.10 g/mol. Its IUPAC name is methyl 2-cyano-4-(4-cyano-1,4-azaborinan-1-yl)benzoate.
| Compound Name | methyl 2-cyano-4-(4-cyano-1,4-azaborinan-1-yl)benzoate |
|---|---|
| PubChem CID | 156711640 |
| Molecular Formula | C14H14BN3O2 |
| Molecular Weight | 267.10 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | methyl 2-cyano-4-(4-cyano-1,4-azaborinan-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCB(C#N)CC2)cc1C#N |
| InChI | InChI=1S/C14H14BN3O2/c1-20-14(19)13-3-2-12(8-11(13)9-16)18-6-4-15(10-17)5-7-18/h2-3,8H,4-7H2,1H3 |
| InChIKey | IVDNWDDDJGQWTG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.10 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|