C14H15BN2O3 — CID 171098238
methyl 5-(4-cyano-1,4-azaborinan-1-yl)-2-formylbenzoate (PubChem CID 171098238) has the molecular formula C14H15BN2O3 and a molecular weight of 270.10 g/mol. Its IUPAC name is methyl 5-(4-cyano-1,4-azaborinan-1-yl)-2-formylbenzoate.
| Compound Name | methyl 5-(4-cyano-1,4-azaborinan-1-yl)-2-formylbenzoate |
|---|---|
| PubChem CID | 171098238 |
| Molecular Formula | C14H15BN2O3 |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | methyl 5-(4-cyano-1,4-azaborinan-1-yl)-2-formylbenzoate |
| SMILES | COC(=O)c1cc(N2CCB(C#N)CC2)ccc1C=O |
| InChI | InChI=1S/C14H15BN2O3/c1-20-14(19)13-8-12(3-2-11(13)9-18)17-6-4-15(10-16)5-7-17/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | JEZPJPWBMMEUOJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|