C23H27NO6 — CID 145375224
1-methoxy-2-prop-2-enoxybenzene;3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 145375224) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-methoxy-2-prop-2-enoxybenzene;3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | 1-methoxy-2-prop-2-enoxybenzene;3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 145375224 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-methoxy-2-prop-2-enoxybenzene;3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | C=C1CN(c2cc(OC)c(OC)c(OC)c2)C1=O.C=CCOc1ccccc1OC |
| InChI | InChI=1S/C13H15NO4.C10H12O2/c1-8-7-14(13(8)15)9-5-10(16-2)12(18-4)11(6-9)17-3;1-3-8-12-10-7-5-4-6-9(10)11-2/h5-6H,1,7H2,2-4H3;3-7H,1,8H2,2H3 |
| InChIKey | CVUXTAAVSGUAKJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|