C27H28N2O4 — CID 145375410
[3-[3-(hydroxymethyl)phenyl]phenyl]methyl (2S,5Z)-5-phenylmethoxyiminopiperidine-2-carboxylate (PubChem CID 145375410) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is [3-[3-(hydroxymethyl)phenyl]phenyl]methyl (2S,5Z)-5-phenylmethoxyiminopiperidine-2-carboxylate.
| Compound Name | [3-[3-(hydroxymethyl)phenyl]phenyl]methyl (2S,5Z)-5-phenylmethoxyiminopiperidine-2-carboxylate |
|---|---|
| PubChem CID | 145375410 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [3-[3-(hydroxymethyl)phenyl]phenyl]methyl (2S,5Z)-5-phenylmethoxyiminopiperidine-2-carboxylate |
| SMILES | O=C(OCc1cccc(-c2cccc(CO)c2)c1)[C@@H]1CC/C(=N/OCc2ccccc2)CN1 |
| InChI | InChI=1S/C27H28N2O4/c30-17-21-8-4-10-23(14-21)24-11-5-9-22(15-24)18-32-27(31)26-13-12-25(16-28-26)29-33-19-20-6-2-1-3-7-20/h1-11,14-15,26,28,30H,12-13,16-19H2/b29-25-/t26-/m0/s1 |
| InChIKey | XXEZFXTUAWBKSY-HFVAWESISA-N |
| XLogP | 4.21 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|