C17H25N5O2 — CID 145375694
N-[(E)-[1-(2-aminoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]amino]-N-methylformamide;ethane (PubChem CID 145375694) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[(E)-[1-(2-aminoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]amino]-N-methylformamide;ethane.
| Compound Name | N-[(E)-[1-(2-aminoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]amino]-N-methylformamide;ethane |
|---|---|
| PubChem CID | 145375694 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[(E)-[1-(2-aminoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]amino]-N-methylformamide;ethane |
| SMILES | CC.Cc1cc2nc(C=O)/c(=N\N(C)C=O)n(CCN)c2cc1C |
| InChI | InChI=1S/C15H19N5O2.C2H6/c1-10-6-12-14(7-11(10)2)20(5-4-16)15(13(8-21)17-12)18-19(3)9-22;1-2/h6-9H,4-5,16H2,1-3H3;1-2H3/b18-15+; |
| InChIKey | TWQSLUFZNAEYLC-FLNCGGNMSA-N |
| XLogP | 1.35 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|