C19H23N5O3 — CID 145375712
3-(2-aminoethyl)-7,8-dimethyl-10-[2-(3-methyloxiran-2-yl)ethyl]benzo[g]pteridine-2,4-dione (PubChem CID 145375712) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-(2-aminoethyl)-7,8-dimethyl-10-[2-(3-methyloxiran-2-yl)ethyl]benzo[g]pteridine-2,4-dione.
| Compound Name | 3-(2-aminoethyl)-7,8-dimethyl-10-[2-(3-methyloxiran-2-yl)ethyl]benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 145375712 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-(2-aminoethyl)-7,8-dimethyl-10-[2-(3-methyloxiran-2-yl)ethyl]benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)n(CCN)c(=O)nc-3n(CCC3OC3C)c2cc1C |
| InChI | InChI=1S/C19H23N5O3/c1-10-8-13-14(9-11(10)2)23(6-4-15-12(3)27-15)17-16(21-13)18(25)24(7-5-20)19(26)22-17/h8-9,12,15H,4-7,20H2,1-3H3 |
| InChIKey | XIFAGZQUFCQQPD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|