C28H40N4O6 — CID 139248212
7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3-undec-10-enylbenzo[g]pteridine-2,4-dione (PubChem CID 139248212) has the molecular formula C28H40N4O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3-undec-10-enylbenzo[g]pteridine-2,4-dione.
| Compound Name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3-undec-10-enylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 139248212 |
| Molecular Formula | C28H40N4O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-3-undec-10-enylbenzo[g]pteridine-2,4-dione |
| SMILES | C=CCCCCCCCCCn1c(=O)nc2n(C[C@H](O)[C@H](O)[C@H](O)CO)c3cc(C)c(C)cc3nc-2c1=O |
| InChI | InChI=1S/C28H40N4O6/c1-4-5-6-7-8-9-10-11-12-13-31-27(37)24-26(30-28(31)38)32(16-22(34)25(36)23(35)17-33)21-15-19(3)18(2)14-20(21)29-24/h4,14-15,22-23,25,33-36H,1,5-13,16-17H2,2-3H3/t22-,23+,25-/m0/s1 |
| InChIKey | RAPSOCINJLBPIR-ARNLJNQMSA-N |
| XLogP | 2.06 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|