C22H28N4O8 — CID 141209014
[7,8-dimethyl-2,4-dioxo-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridin-3-yl] pentanoate (PubChem CID 141209014) has the molecular formula C22H28N4O8 and a molecular weight of 476.49 g/mol. Its IUPAC name is [7,8-dimethyl-2,4-dioxo-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridin-3-yl] pentanoate.
| Compound Name | [7,8-dimethyl-2,4-dioxo-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridin-3-yl] pentanoate |
|---|---|
| PubChem CID | 141209014 |
| Molecular Formula | C22H28N4O8 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [7,8-dimethyl-2,4-dioxo-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridin-3-yl] pentanoate |
| SMILES | CCCCC(=O)On1c(=O)nc2n(CC(O)C(O)C(O)CO)c3cc(C)c(C)cc3nc-2c1=O |
| InChI | InChI=1S/C22H28N4O8/c1-4-5-6-17(30)34-26-21(32)18-20(24-22(26)33)25(9-15(28)19(31)16(29)10-27)14-8-12(3)11(2)7-13(14)23-18/h7-8,15-16,19,27-29,31H,4-6,9-10H2,1-3H3 |
| InChIKey | WUOZXPIJGNTGNW-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|