C17H20N4O6 — CID 146659043
6,7-dimethyl-3-(1,3,4-oxadiazol-2-yl)-1-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxalin-2-one (PubChem CID 146659043) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is 6,7-dimethyl-3-(1,3,4-oxadiazol-2-yl)-1-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxalin-2-one.
| Compound Name | 6,7-dimethyl-3-(1,3,4-oxadiazol-2-yl)-1-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 146659043 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 6,7-dimethyl-3-(1,3,4-oxadiazol-2-yl)-1-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]quinoxalin-2-one |
| SMILES | Cc1cc2nc(-c3nnco3)c(=O)n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C |
| InChI | InChI=1S/C17H20N4O6/c1-8-3-10-11(4-9(8)2)21(5-12(23)15(25)13(24)6-22)17(26)14(19-10)16-20-18-7-27-16/h3-4,7,12-13,15,22-25H,5-6H2,1-2H3/t12-,13+,15-/m0/s1 |
| InChIKey | MVCSYYAQQQRSLE-GUTXKFCHSA-N |
| XLogP | -0.86 |
| TPSA | 154.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |