C20H28N6O5 — CID 146659000
1-[(2S,3R,4R)-5-amino-2,3,4-trihydroxypentyl]-3-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]-6,7-dimethylquinoxalin-2-one (PubChem CID 146659000) has the molecular formula C20H28N6O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-[(2S,3R,4R)-5-amino-2,3,4-trihydroxypentyl]-3-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]-6,7-dimethylquinoxalin-2-one.
| Compound Name | 1-[(2S,3R,4R)-5-amino-2,3,4-trihydroxypentyl]-3-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]-6,7-dimethylquinoxalin-2-one |
|---|---|
| PubChem CID | 146659000 |
| Molecular Formula | C20H28N6O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 1-[(2S,3R,4R)-5-amino-2,3,4-trihydroxypentyl]-3-[3-[(dimethylamino)methyl]-1,2,4-oxadiazol-5-yl]-6,7-dimethylquinoxalin-2-one |
| SMILES | Cc1cc2nc(-c3nc(CN(C)C)no3)c(=O)n(C[C@H](O)[C@H](O)[C@H](O)CN)c2cc1C |
| InChI | InChI=1S/C20H28N6O5/c1-10-5-12-13(6-11(10)2)26(8-15(28)18(29)14(27)7-21)20(30)17(22-12)19-23-16(24-31-19)9-25(3)4/h5-6,14-15,18,27-29H,7-9,21H2,1-4H3/t14-,15+,18-/m1/s1 |
| InChIKey | SMZVXUAVMWBECJ-RVKKMQEKSA-N |
| XLogP | -0.83 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |