C23H34N8O6 — CID 146659009
N-[2-(dimethylamino)ethyl]-2-[(2R,3S,4S)-5-[6,7-dimethyl-3-(1-methyltetrazol-5-yl)-2-oxoquinoxalin-1-yl]-2,3,4-trihydroxypentoxy]acetamide (PubChem CID 146659009) has the molecular formula C23H34N8O6 and a molecular weight of 518.58 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[(2R,3S,4S)-5-[6,7-dimethyl-3-(1-methyltetrazol-5-yl)-2-oxoquinoxalin-1-yl]-2,3,4-trihydroxypentoxy]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[(2R,3S,4S)-5-[6,7-dimethyl-3-(1-methyltetrazol-5-yl)-2-oxoquinoxalin-1-yl]-2,3,4-trihydroxypentoxy]acetamide |
|---|---|
| PubChem CID | 146659009 |
| Molecular Formula | C23H34N8O6 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[(2R,3S,4S)-5-[6,7-dimethyl-3-(1-methyltetrazol-5-yl)-2-oxoquinoxalin-1-yl]-2,3,4-trihydroxypentoxy]acetamide |
| SMILES | Cc1cc2nc(-c3nnnn3C)c(=O)n(C[C@H](O)[C@H](O)[C@H](O)COCC(=O)NCCN(C)C)c2cc1C |
| InChI | InChI=1S/C23H34N8O6/c1-13-8-15-16(9-14(13)2)31(23(36)20(25-15)22-26-27-28-30(22)5)10-17(32)21(35)18(33)11-37-12-19(34)24-6-7-29(3)4/h8-9,17-18,21,32-33,35H,6-7,10-12H2,1-5H3,(H,24,34)/t17-,18+,21-/m0/s1 |
| InChIKey | XJRIFDNZIXKMIC-UEXGIBASSA-N |
| XLogP | -2.02 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |