C26H30N6O11 — CID 146659050
2-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]acetic acid (PubChem CID 146659050) has the molecular formula C26H30N6O11 and a molecular weight of 602.56 g/mol. Its IUPAC name is 2-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]acetic acid.
| Compound Name | 2-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 146659050 |
| Molecular Formula | C26H30N6O11 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 2-[5-[6,7-dimethyl-3-oxo-4-[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentyl]quinoxalin-2-yl]tetrazol-1-yl]acetic acid |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](Cn1c(=O)c(-c2nnnn2CC(=O)O)nc2cc(C)c(C)cc21)OC(C)=O |
| InChI | InChI=1S/C26H30N6O11/c1-12-7-18-19(8-13(12)2)31(26(39)23(27-18)25-28-29-30-32(25)10-22(37)38)9-20(41-15(4)34)24(43-17(6)36)21(42-16(5)35)11-40-14(3)33/h7-8,20-21,24H,9-11H2,1-6H3,(H,37,38)/t20-,21+,24-/m0/s1 |
| InChIKey | XRWKPONVKZAERM-IMSXRSKXSA-N |
| XLogP | 0.11 |
| TPSA | 220.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|