C41H60N4O10 — CID 154720356
[(2S,3R,4R)-2,3,4-tris(2,2-dimethylbutanoyloxy)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] 2,2-dimethylbutanoate (PubChem CID 154720356) has the molecular formula C41H60N4O10 and a molecular weight of 768.95 g/mol. Its IUPAC name is [(2S,3R,4R)-2,3,4-tris(2,2-dimethylbutanoyloxy)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] 2,2-dimethylbutanoate.
| Compound Name | [(2S,3R,4R)-2,3,4-tris(2,2-dimethylbutanoyloxy)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 154720356 |
| Molecular Formula | C41H60N4O10 |
| Molecular Weight | 768.95 g/mol |
| Exact Mass | 768.43 |
| IUPAC Name | [(2S,3R,4R)-2,3,4-tris(2,2-dimethylbutanoyloxy)-5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)pentyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC[C@H](OC(=O)C(C)(C)CC)[C@H](OC(=O)C(C)(C)CC)[C@@H](Cn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C41H60N4O10/c1-15-38(7,8)33(47)52-22-28(54-35(49)40(11,12)17-3)30(55-36(50)41(13,14)18-4)27(53-34(48)39(9,10)16-2)21-45-26-20-24(6)23(5)19-25(26)42-29-31(45)43-37(51)44-32(29)46/h19-20,27-28,30H,15-18,21-22H2,1-14H3,(H,44,46,51)/t27-,28+,30-/m1/s1 |
| InChIKey | ROKRMXXBYVFNDP-OYKXOOMRSA-N |
| XLogP | 6.22 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.95 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|