C31H42N6O10 — CID 149016523
[4-butanoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,5-bis[[2-(methylamino)acetyl]oxy]pentan-2-yl] butanoate (PubChem CID 149016523) has the molecular formula C31H42N6O10 and a molecular weight of 658.71 g/mol. Its IUPAC name is [4-butanoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,5-bis[[2-(methylamino)acetyl]oxy]pentan-2-yl] butanoate.
| Compound Name | [4-butanoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,5-bis[[2-(methylamino)acetyl]oxy]pentan-2-yl] butanoate |
|---|---|
| PubChem CID | 149016523 |
| Molecular Formula | C31H42N6O10 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | [4-butanoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-3,5-bis[[2-(methylamino)acetyl]oxy]pentan-2-yl] butanoate |
| SMILES | CCCC(=O)OC(COC(=O)CNC)C(OC(=O)CNC)C(Cn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21)OC(=O)CCC |
| InChI | InChI=1S/C31H42N6O10/c1-7-9-23(38)45-21(28(47-26(41)14-33-6)22(46-24(39)10-8-2)16-44-25(40)13-32-5)15-37-20-12-18(4)17(3)11-19(20)34-27-29(37)35-31(43)36-30(27)42/h11-12,21-22,28,32-33H,7-10,13-16H2,1-6H3,(H,36,42,43) |
| InChIKey | QCQHNGSTAZDZLN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|