C21H20N4O10 — CID 10254919
[5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-triformyloxypentyl] formate (PubChem CID 10254919) has the molecular formula C21H20N4O10 and a molecular weight of 488.41 g/mol. Its IUPAC name is [5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-triformyloxypentyl] formate.
| Compound Name | [5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-triformyloxypentyl] formate |
|---|---|
| PubChem CID | 10254919 |
| Molecular Formula | C21H20N4O10 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [5-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-2,3,4-triformyloxypentyl] formate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(OC=O)C(OC=O)C(COC=O)OC=O)c2cc1C |
| InChI | InChI=1S/C21H20N4O10/c1-11-3-13-14(4-12(11)2)25(19-17(22-13)20(30)24-21(31)23-19)5-15(33-8-27)18(35-10-29)16(34-9-28)6-32-7-26/h3-4,7-10,15-16,18H,5-6H2,1-2H3,(H,24,30,31) |
| InChIKey | MLFJLWCHGDWFNG-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|