C38H32N4O9 — CID 124917504
[(2S,3S,4S)-3,4-dibenzoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxypentan-2-yl] benzoate (PubChem CID 124917504) has the molecular formula C38H32N4O9 and a molecular weight of 688.69 g/mol. Its IUPAC name is [(2S,3S,4S)-3,4-dibenzoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxypentan-2-yl] benzoate.
| Compound Name | [(2S,3S,4S)-3,4-dibenzoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxypentan-2-yl] benzoate |
|---|---|
| PubChem CID | 124917504 |
| Molecular Formula | C38H32N4O9 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | [(2S,3S,4S)-3,4-dibenzoyloxy-1-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)-5-hydroxypentan-2-yl] benzoate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C[C@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H](CO)OC(=O)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C38H32N4O9/c1-22-18-27-28(19-23(22)2)42(33-31(39-27)34(44)41-38(48)40-33)20-29(49-35(45)24-12-6-3-7-13-24)32(51-37(47)26-16-10-5-11-17-26)30(21-43)50-36(46)25-14-8-4-9-15-25/h3-19,29-30,32,43H,20-21H2,1-2H3,(H,41,44,48)/t29-,30-,32-/m0/s1 |
| InChIKey | BDBORWYMDBTTFI-GCRSFRQPSA-N |
| XLogP | 3.87 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|